C11H14N2O — CID 55270810
(3R)-3-amino-3-(3-methoxy-4-methylphenyl)propanenitrile (PubChem CID 55270810) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is (3R)-3-amino-3-(3-methoxy-4-methylphenyl)propanenitrile.
| Compound Name | (3R)-3-amino-3-(3-methoxy-4-methylphenyl)propanenitrile |
|---|---|
| PubChem CID | 55270810 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (3R)-3-amino-3-(3-methoxy-4-methylphenyl)propanenitrile |
| SMILES | COc1cc([C@H](N)CC#N)ccc1C |
| InChI | InChI=1S/C11H14N2O/c1-8-3-4-9(7-11(8)14-2)10(13)5-6-12/h3-4,7,10H,5,13H2,1-2H3/t10-/m1/s1 |
| InChIKey | RHYQEQRNNRYVKY-SNVBAGLBSA-N |
| XLogP | 1.92 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |