C10H11FN2O — CID 55297807
3-amino-3-(4-fluoro-3-methoxyphenyl)propanenitrile (PubChem CID 55297807) has the molecular formula C10H11FN2O and a molecular weight of 194.21 g/mol. Its IUPAC name is 3-amino-3-(4-fluoro-3-methoxyphenyl)propanenitrile.
| Compound Name | 3-amino-3-(4-fluoro-3-methoxyphenyl)propanenitrile |
|---|---|
| PubChem CID | 55297807 |
| Molecular Formula | C10H11FN2O |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 3-amino-3-(4-fluoro-3-methoxyphenyl)propanenitrile |
| SMILES | COc1cc(C(N)CC#N)ccc1F |
| InChI | InChI=1S/C10H11FN2O/c1-14-10-6-7(2-3-8(10)11)9(13)4-5-12/h2-3,6,9H,4,13H2,1H3 |
| InChIKey | CYAZFLBQRLRSTJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |