C10H11FN2 — CID 55277483
(3R)-3-amino-3-(4-fluoro-3-methylphenyl)propanenitrile (PubChem CID 55277483) has the molecular formula C10H11FN2 and a molecular weight of 178.21 g/mol. Its IUPAC name is (3R)-3-amino-3-(4-fluoro-3-methylphenyl)propanenitrile.
| Compound Name | (3R)-3-amino-3-(4-fluoro-3-methylphenyl)propanenitrile |
|---|---|
| PubChem CID | 55277483 |
| Molecular Formula | C10H11FN2 |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | (3R)-3-amino-3-(4-fluoro-3-methylphenyl)propanenitrile |
| SMILES | Cc1cc([C@H](N)CC#N)ccc1F |
| InChI | InChI=1S/C10H11FN2/c1-7-6-8(2-3-9(7)11)10(13)4-5-12/h2-3,6,10H,4,13H2,1H3/t10-/m1/s1 |
| InChIKey | HYFHABCUOIGKES-SNVBAGLBSA-N |
| XLogP | 2.05 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |