C12H17ClN2O2 — CID 171260571
(3R)-3-amino-3-(3-ethoxy-4-methoxyphenyl)propanenitrile;hydrochloride (PubChem CID 171260571) has the molecular formula C12H17ClN2O2 and a molecular weight of 256.73 g/mol. Its IUPAC name is (3R)-3-amino-3-(3-ethoxy-4-methoxyphenyl)propanenitrile;hydrochloride.
| Compound Name | (3R)-3-amino-3-(3-ethoxy-4-methoxyphenyl)propanenitrile;hydrochloride |
|---|---|
| PubChem CID | 171260571 |
| Molecular Formula | C12H17ClN2O2 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | (3R)-3-amino-3-(3-ethoxy-4-methoxyphenyl)propanenitrile;hydrochloride |
| SMILES | CCOc1cc([C@H](N)CC#N)ccc1OC.Cl |
| InChI | InChI=1S/C12H16N2O2.ClH/c1-3-16-12-8-9(10(14)6-7-13)4-5-11(12)15-2;/h4-5,8,10H,3,6,14H2,1-2H3;1H/t10-;/m1./s1 |
| InChIKey | WXNPOKWPHDRCIR-HNCPQSOCSA-N |
| XLogP | 2.43 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |