C11H17ClFNO2 — CID 171210798
(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-fluoroethanamine;hydrochloride (PubChem CID 171210798) has the molecular formula C11H17ClFNO2 and a molecular weight of 249.71 g/mol. Its IUPAC name is (1S)-1-(3-ethoxy-4-methoxyphenyl)-2-fluoroethanamine;hydrochloride.
| Compound Name | (1S)-1-(3-ethoxy-4-methoxyphenyl)-2-fluoroethanamine;hydrochloride |
|---|---|
| PubChem CID | 171210798 |
| Molecular Formula | C11H17ClFNO2 |
| Molecular Weight | 249.71 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | (1S)-1-(3-ethoxy-4-methoxyphenyl)-2-fluoroethanamine;hydrochloride |
| SMILES | CCOc1cc([C@H](N)CF)ccc1OC.Cl |
| InChI | InChI=1S/C11H16FNO2.ClH/c1-3-15-11-6-8(9(13)7-12)4-5-10(11)14-2;/h4-6,9H,3,7,13H2,1-2H3;1H/t9-;/m1./s1 |
| InChIKey | AGLAOASEYYZIAJ-SBSPUUFOSA-N |
| XLogP | 2.48 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.71 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |