C10H11BrN2O — CID 131168095
(3R)-3-amino-3-(3-bromo-4-methoxyphenyl)propanenitrile (PubChem CID 131168095) has the molecular formula C10H11BrN2O and a molecular weight of 255.12 g/mol. Its IUPAC name is (3R)-3-amino-3-(3-bromo-4-methoxyphenyl)propanenitrile.
| Compound Name | (3R)-3-amino-3-(3-bromo-4-methoxyphenyl)propanenitrile |
|---|---|
| PubChem CID | 131168095 |
| Molecular Formula | C10H11BrN2O |
| Molecular Weight | 255.12 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | (3R)-3-amino-3-(3-bromo-4-methoxyphenyl)propanenitrile |
| SMILES | COc1ccc([C@H](N)CC#N)cc1Br |
| InChI | InChI=1S/C10H11BrN2O/c1-14-10-3-2-7(6-8(10)11)9(13)4-5-12/h2-3,6,9H,4,13H2,1H3/t9-/m1/s1 |
| InChIKey | XVJZJNUWFYGDCO-SECBINFHSA-N |
| XLogP | 2.37 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.12 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |