C13H17NO5 — CID 171901859
3,4-dihydroxy-4-(3,4,5-trimethoxyphenyl)butanenitrile (PubChem CID 171901859) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(3,4,5-trimethoxyphenyl)butanenitrile.
| Compound Name | 3,4-dihydroxy-4-(3,4,5-trimethoxyphenyl)butanenitrile |
|---|---|
| PubChem CID | 171901859 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 3,4-dihydroxy-4-(3,4,5-trimethoxyphenyl)butanenitrile |
| SMILES | COc1cc(C(O)C(O)CC#N)cc(OC)c1OC |
| InChI | InChI=1S/C13H17NO5/c1-17-10-6-8(12(16)9(15)4-5-14)7-11(18-2)13(10)19-3/h6-7,9,12,15-16H,4H2,1-3H3 |
| InChIKey | XCWDMZBUCKJYJH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 91.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |