C11H14N2O2 — CID 171900704
4-(3-amino-5-methylphenyl)-3,4-dihydroxybutanenitrile (PubChem CID 171900704) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 4-(3-amino-5-methylphenyl)-3,4-dihydroxybutanenitrile.
| Compound Name | 4-(3-amino-5-methylphenyl)-3,4-dihydroxybutanenitrile |
|---|---|
| PubChem CID | 171900704 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 4-(3-amino-5-methylphenyl)-3,4-dihydroxybutanenitrile |
| SMILES | Cc1cc(N)cc(C(O)C(O)CC#N)c1 |
| InChI | InChI=1S/C11H14N2O2/c1-7-4-8(6-9(13)5-7)11(15)10(14)2-3-12/h4-6,10-11,14-15H,2,13H2,1H3 |
| InChIKey | FCVWJGOIQGNYDN-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|