C16H16N2O3 — CID 171901985
4-[4-(4-aminophenoxy)phenyl]-3,4-dihydroxybutanenitrile (PubChem CID 171901985) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is 4-[4-(4-aminophenoxy)phenyl]-3,4-dihydroxybutanenitrile.
| Compound Name | 4-[4-(4-aminophenoxy)phenyl]-3,4-dihydroxybutanenitrile |
|---|---|
| PubChem CID | 171901985 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 4-[4-(4-aminophenoxy)phenyl]-3,4-dihydroxybutanenitrile |
| SMILES | N#CCC(O)C(O)c1ccc(Oc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C16H16N2O3/c17-10-9-15(19)16(20)11-1-5-13(6-2-11)21-14-7-3-12(18)4-8-14/h1-8,15-16,19-20H,9,18H2 |
| InChIKey | OTDITVULEBARKI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|