C13H13N3O2S — CID 171901779
4-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-3,4-dihydroxybutanenitrile (PubChem CID 171901779) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is 4-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-3,4-dihydroxybutanenitrile.
| Compound Name | 4-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-3,4-dihydroxybutanenitrile |
|---|---|
| PubChem CID | 171901779 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 4-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-3,4-dihydroxybutanenitrile |
| SMILES | N#CCC(O)C(O)c1ccc(-c2csc(N)n2)cc1 |
| InChI | InChI=1S/C13H13N3O2S/c14-6-5-11(17)12(18)9-3-1-8(2-4-9)10-7-19-13(15)16-10/h1-4,7,11-12,17-18H,5H2,(H2,15,16) |
| InChIKey | BEYCURAJQNOLES-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |