C11H11N5O2 — CID 171901714
3,4-dihydroxy-4-[4-(2H-tetrazol-5-yl)phenyl]butanenitrile (PubChem CID 171901714) has the molecular formula C11H11N5O2 and a molecular weight of 245.24 g/mol. Its IUPAC name is 3,4-dihydroxy-4-[4-(2H-tetrazol-5-yl)phenyl]butanenitrile.
| Compound Name | 3,4-dihydroxy-4-[4-(2H-tetrazol-5-yl)phenyl]butanenitrile |
|---|---|
| PubChem CID | 171901714 |
| Molecular Formula | C11H11N5O2 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 3,4-dihydroxy-4-[4-(2H-tetrazol-5-yl)phenyl]butanenitrile |
| SMILES | N#CCC(O)C(O)c1ccc(-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C11H11N5O2/c12-6-5-9(17)10(18)7-1-3-8(4-2-7)11-13-15-16-14-11/h1-4,9-10,17-18H,5H2,(H,13,14,15,16) |
| InChIKey | SPNYHZABGOPMBO-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 118.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |