About 4-[4-(2-aminoacetyl)phenyl]-3,4-dihydroxybutanenitrile
4-[4-(2-aminoacetyl)phenyl]-3,4-dihydroxybutanenitrile (PubChem CID 171901455) has the molecular formula C12H14N2O3
and a molecular weight of 234.25 g/mol. Its IUPAC name is 4-[4-(2-aminoacetyl)phenyl]-3,4-dihydroxybutanenitrile.
Molecular Properties
| Compound Name | 4-[4-(2-aminoacetyl)phenyl]-3,4-dihydroxybutanenitrile |
| PubChem CID | 171901455 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 4-[4-(2-aminoacetyl)phenyl]-3,4-dihydroxybutanenitrile |
| SMILES | N#CCC(O)C(O)c1ccc(C(=O)CN)cc1 |
| InChI | InChI=1S/C12H14N2O3/c13-6-5-10(15)12(17)9-3-1-8(2-4-9)11(16)7-14/h1-4,10,12,15,17H,5,7,14H2 |
| InChIKey | ZTOOIYGDGHWXCP-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-(2-aminoacetyl)phenyl]-3,4-dihydroxybutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2-aminoacetyl)phenyl]-3,4-dihydroxybutanenitrile?
The IUPAC name of 4-[4-(2-aminoacetyl)phenyl]-3,4-dihydroxybutanenitrile (CID 171901455) is 4-[4-(2-aminoacetyl)phenyl]-3,4-dihydroxybutanenitrile.
What is the SMILES notation for 4-[4-(2-aminoacetyl)phenyl]-3,4-dihydroxybutanenitrile?
The canonical SMILES for 4-[4-(2-aminoacetyl)phenyl]-3,4-dihydroxybutanenitrile is N#CCC(O)C(O)c1ccc(C(=O)CN)cc1.
What is the InChIKey of 4-[4-(2-aminoacetyl)phenyl]-3,4-dihydroxybutanenitrile?
The InChIKey is ZTOOIYGDGHWXCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O3/c13-6-5-10(15)12(17)9-3-1-8(2-4-9)11(16)7-14/h1-4,10,12,15,17H,5,7,14H2.
What are the key properties of 4-[4-(2-aminoacetyl)phenyl]-3,4-dihydroxybutanenitrile?
4-[4-(2-aminoacetyl)phenyl]-3,4-dihydroxybutanenitrile has a molecular weight of 234.25 g/mol, XLogP of 0.14, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2-aminoacetyl)phenyl]-3,4-dihydroxybutanenitrile is sourced from PubChem (CID 171901455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).