C15H17NO4S — CID 171876584
S-[4-[4-(2-cyanoacetyl)phenyl]-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171876584) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is S-[4-[4-(2-cyanoacetyl)phenyl]-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-[4-(2-cyanoacetyl)phenyl]-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171876584 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | S-[4-[4-(2-cyanoacetyl)phenyl]-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1ccc(C(=O)CC#N)cc1 |
| InChI | InChI=1S/C15H17NO4S/c1-10(17)21-9-7-14(19)15(20)12-4-2-11(3-5-12)13(18)6-8-16/h2-5,14-15,19-20H,6-7,9H2,1H3 |
| InChIKey | CEWKUBKNEGBQGK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|