C10H15N3O3S — CID 171875400
S-[4-(2-aminopyrimidin-5-yl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171875400) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is S-[4-(2-aminopyrimidin-5-yl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(2-aminopyrimidin-5-yl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171875400 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | S-[4-(2-aminopyrimidin-5-yl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1cnc(N)nc1 |
| InChI | InChI=1S/C10H15N3O3S/c1-6(14)17-3-2-8(15)9(16)7-4-12-10(11)13-5-7/h4-5,8-9,15-16H,2-3H2,1H3,(H2,11,12,13) |
| InChIKey | BQKJGLXVIQGGEF-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|