C11H13N3O3S — CID 171875690
S-[4-(2-cyanopyrimidin-5-yl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171875690) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is S-[4-(2-cyanopyrimidin-5-yl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(2-cyanopyrimidin-5-yl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171875690 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | S-[4-(2-cyanopyrimidin-5-yl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1cnc(C#N)nc1 |
| InChI | InChI=1S/C11H13N3O3S/c1-7(15)18-3-2-9(16)11(17)8-5-13-10(4-12)14-6-8/h5-6,9,11,16-17H,2-3H2,1H3 |
| InChIKey | MWYUAJXSBZSWAY-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|