C13H16F3NO4S — CID 171876810
S-[3,4-dihydroxy-4-[6-methoxy-5-(trifluoromethyl)-3-pyridinyl]butyl] ethanethioate (PubChem CID 171876810) has the molecular formula C13H16F3NO4S and a molecular weight of 339.34 g/mol. Its IUPAC name is S-[3,4-dihydroxy-4-[6-methoxy-5-(trifluoromethyl)-3-pyridinyl]butyl] ethanethioate.
| Compound Name | S-[3,4-dihydroxy-4-[6-methoxy-5-(trifluoromethyl)-3-pyridinyl]butyl] ethanethioate |
|---|---|
| PubChem CID | 171876810 |
| Molecular Formula | C13H16F3NO4S |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | S-[3,4-dihydroxy-4-[6-methoxy-5-(trifluoromethyl)-3-pyridinyl]butyl] ethanethioate |
| SMILES | COc1ncc(C(O)C(O)CCSC(C)=O)cc1C(F)(F)F |
| InChI | InChI=1S/C13H16F3NO4S/c1-7(18)22-4-3-10(19)11(20)8-5-9(13(14,15)16)12(21-2)17-6-8/h5-6,10-11,19-20H,3-4H2,1-2H3 |
| InChIKey | CECUKVJLJMRUQB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|