C14H20O5S — CID 171876182
S-[4-(3,4-dimethoxyphenyl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171876182) has the molecular formula C14H20O5S and a molecular weight of 300.38 g/mol. Its IUPAC name is S-[4-(3,4-dimethoxyphenyl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(3,4-dimethoxyphenyl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171876182 |
| Molecular Formula | C14H20O5S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | S-[4-(3,4-dimethoxyphenyl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | COc1ccc(C(O)C(O)CCSC(C)=O)cc1OC |
| InChI | InChI=1S/C14H20O5S/c1-9(15)20-7-6-11(16)14(17)10-4-5-12(18-2)13(8-10)19-3/h4-5,8,11,14,16-17H,6-7H2,1-3H3 |
| InChIKey | SMNXIRGLJCEWJV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|