C16H20O6S — CID 171876835
(E)-3-[5-(4-acetylsulfanyl-1,2-dihydroxybutyl)-2-methoxyphenyl]prop-2-enoic acid (PubChem CID 171876835) has the molecular formula C16H20O6S and a molecular weight of 340.40 g/mol. Its IUPAC name is (E)-3-[5-(4-acetylsulfanyl-1,2-dihydroxybutyl)-2-methoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(4-acetylsulfanyl-1,2-dihydroxybutyl)-2-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 171876835 |
| Molecular Formula | C16H20O6S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | (E)-3-[5-(4-acetylsulfanyl-1,2-dihydroxybutyl)-2-methoxyphenyl]prop-2-enoic acid |
| SMILES | COc1ccc(C(O)C(O)CCSC(C)=O)cc1/C=C/C(=O)O |
| InChI | InChI=1S/C16H20O6S/c1-10(17)23-8-7-13(18)16(21)12-3-5-14(22-2)11(9-12)4-6-15(19)20/h3-6,9,13,16,18,21H,7-8H2,1-2H3,(H,19,20)/b6-4+ |
| InChIKey | MCNXWVRAJYJXQY-GQCTYLIASA-N |
| XLogP | 1.86 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|