C28H27NO7 — CID 170835124
(E)-3-[5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxypropyl]-2-methoxyphenyl]prop-2-enoic acid (PubChem CID 170835124) has the molecular formula C28H27NO7 and a molecular weight of 489.52 g/mol. Its IUPAC name is (E)-3-[5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxypropyl]-2-methoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxypropyl]-2-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 170835124 |
| Molecular Formula | C28H27NO7 |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | (E)-3-[5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxypropyl]-2-methoxyphenyl]prop-2-enoic acid |
| SMILES | COc1ccc(C(O)C(O)CNC(=O)OCC2c3ccccc3-c3ccccc32)cc1/C=C/C(=O)O |
| InChI | InChI=1S/C28H27NO7/c1-35-25-12-10-18(14-17(25)11-13-26(31)32)27(33)24(30)15-29-28(34)36-16-23-21-8-4-2-6-19(21)20-7-3-5-9-22(20)23/h2-14,23-24,27,30,33H,15-16H2,1H3,(H,29,34)(H,31,32)/b13-11+ |
| InChIKey | RGRXMNKGUGQXHZ-ACCUITESSA-N |
| XLogP | 3.73 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|