C27H24FNO6 — CID 170835029
(E)-3-[5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxypropyl]-2-fluorophenyl]prop-2-enoic acid (PubChem CID 170835029) has the molecular formula C27H24FNO6 and a molecular weight of 477.49 g/mol. Its IUPAC name is (E)-3-[5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxypropyl]-2-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxypropyl]-2-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 170835029 |
| Molecular Formula | C27H24FNO6 |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | (E)-3-[5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxypropyl]-2-fluorophenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(C(O)C(O)CNC(=O)OCC2c3ccccc3-c3ccccc32)ccc1F |
| InChI | InChI=1S/C27H24FNO6/c28-23-11-9-17(13-16(23)10-12-25(31)32)26(33)24(30)14-29-27(34)35-15-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-13,22,24,26,30,33H,14-15H2,(H,29,34)(H,31,32)/b12-10+ |
| InChIKey | MXDGJMVMTBLWET-ZRDIBKRKSA-N |
| XLogP | 3.86 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|