C24H20F3NO4 — CID 170834000
9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(3,4,5-trifluorophenyl)propyl]carbamate (PubChem CID 170834000) has the molecular formula C24H20F3NO4 and a molecular weight of 443.42 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(3,4,5-trifluorophenyl)propyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(3,4,5-trifluorophenyl)propyl]carbamate |
|---|---|
| PubChem CID | 170834000 |
| Molecular Formula | C24H20F3NO4 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(3,4,5-trifluorophenyl)propyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1cc(F)c(F)c(F)c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H20F3NO4/c25-19-9-13(10-20(26)22(19)27)23(30)21(29)11-28-24(31)32-12-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-10,18,21,23,29-30H,11-12H2,(H,28,31) |
| InChIKey | QKMGVCCWCLWIFL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|