C24H20F2N2O6 — CID 170834866
9H-fluoren-9-ylmethyl N-[3-(3,5-difluoro-4-nitrophenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170834866) has the molecular formula C24H20F2N2O6 and a molecular weight of 470.43 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(3,5-difluoro-4-nitrophenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(3,5-difluoro-4-nitrophenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170834866 |
| Molecular Formula | C24H20F2N2O6 |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(3,5-difluoro-4-nitrophenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1cc(F)c([N+](=O)[O-])c(F)c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H20F2N2O6/c25-19-9-13(10-20(26)22(19)28(32)33)23(30)21(29)11-27-24(31)34-12-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-10,18,21,23,29-30H,11-12H2,(H,27,31) |
| InChIKey | PMWGMCIZWPXTSO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|