C26H24N2O8 — CID 170835132
2-[4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxypropyl]-2-nitrophenyl]acetic acid (PubChem CID 170835132) has the molecular formula C26H24N2O8 and a molecular weight of 492.48 g/mol. Its IUPAC name is 2-[4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxypropyl]-2-nitrophenyl]acetic acid.
| Compound Name | 2-[4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxypropyl]-2-nitrophenyl]acetic acid |
|---|---|
| PubChem CID | 170835132 |
| Molecular Formula | C26H24N2O8 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 2-[4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxypropyl]-2-nitrophenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(C(O)C(O)CNC(=O)OCC2c3ccccc3-c3ccccc32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H24N2O8/c29-23(25(32)16-10-9-15(12-24(30)31)22(11-16)28(34)35)13-27-26(33)36-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-11,21,23,25,29,32H,12-14H2,(H,27,33)(H,30,31) |
| InChIKey | FJPSWWJHMPDQJI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 159.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|