C27H26N2O8 — CID 170835179
methyl 5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxypropyl]-2-methyl-3-nitrobenzoate (PubChem CID 170835179) has the molecular formula C27H26N2O8 and a molecular weight of 506.51 g/mol. Its IUPAC name is methyl 5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxypropyl]-2-methyl-3-nitrobenzoate.
| Compound Name | methyl 5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxypropyl]-2-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 170835179 |
| Molecular Formula | C27H26N2O8 |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | methyl 5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-1,2-dihydroxypropyl]-2-methyl-3-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(O)C(O)CNC(=O)OCC2c3ccccc3-c3ccccc32)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C27H26N2O8/c1-15-21(26(32)36-2)11-16(12-23(15)29(34)35)25(31)24(30)13-28-27(33)37-14-22-19-9-5-3-7-17(19)18-8-4-6-10-20(18)22/h3-12,22,24-25,30-31H,13-14H2,1-2H3,(H,28,33) |
| InChIKey | VOQAGAXVAFYUSU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|