C23H20ClN3O6 — CID 170834543
9H-fluoren-9-ylmethyl N-[3-(5-chloro-3-nitro-2-pyridinyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170834543) has the molecular formula C23H20ClN3O6 and a molecular weight of 469.88 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(5-chloro-3-nitro-2-pyridinyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(5-chloro-3-nitro-2-pyridinyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170834543 |
| Molecular Formula | C23H20ClN3O6 |
| Molecular Weight | 469.88 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(5-chloro-3-nitro-2-pyridinyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1ncc(Cl)cc1[N+](=O)[O-])OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H20ClN3O6/c24-13-9-19(27(31)32)21(25-10-13)22(29)20(28)11-26-23(30)33-12-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-10,18,20,22,28-29H,11-12H2,(H,26,30) |
| InChIKey | SXEFUGXBCZTYNL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 134.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.88 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|