C16H16ClN3O6 — CID 171856292
benzyl N-[3-(5-chloro-3-nitro-2-pyridinyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171856292) has the molecular formula C16H16ClN3O6 and a molecular weight of 381.77 g/mol. Its IUPAC name is benzyl N-[3-(5-chloro-3-nitro-2-pyridinyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(5-chloro-3-nitro-2-pyridinyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171856292 |
| Molecular Formula | C16H16ClN3O6 |
| Molecular Weight | 381.77 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | benzyl N-[3-(5-chloro-3-nitro-2-pyridinyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1ncc(Cl)cc1[N+](=O)[O-])OCc1ccccc1 |
| InChI | InChI=1S/C16H16ClN3O6/c17-11-6-12(20(24)25)14(18-7-11)15(22)13(21)8-19-16(23)26-9-10-4-2-1-3-5-10/h1-7,13,15,21-22H,8-9H2,(H,19,23) |
| InChIKey | XPFKMCAXGZZIFG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 134.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.77 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|