C20H19ClN2O4 — CID 171856690
benzyl N-[3-(1-chloroisoquinolin-4-yl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171856690) has the molecular formula C20H19ClN2O4 and a molecular weight of 386.84 g/mol. Its IUPAC name is benzyl N-[3-(1-chloroisoquinolin-4-yl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(1-chloroisoquinolin-4-yl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171856690 |
| Molecular Formula | C20H19ClN2O4 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | benzyl N-[3-(1-chloroisoquinolin-4-yl)-2,3-dihydroxypropyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1cnc(Cl)c2ccccc12)OCc1ccccc1 |
| InChI | InChI=1S/C20H19ClN2O4/c21-19-15-9-5-4-8-14(15)16(10-22-19)18(25)17(24)11-23-20(26)27-12-13-6-2-1-3-7-13/h1-10,17-18,24-25H,11-12H2,(H,23,26) |
| InChIKey | VRXKHYIGLAUTJB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|