C17H20ClN3O4 — CID 171888075
benzyl N-[4-(5-amino-2-chloro-3-pyridinyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171888075) has the molecular formula C17H20ClN3O4 and a molecular weight of 365.82 g/mol. Its IUPAC name is benzyl N-[4-(5-amino-2-chloro-3-pyridinyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | benzyl N-[4-(5-amino-2-chloro-3-pyridinyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171888075 |
| Molecular Formula | C17H20ClN3O4 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | benzyl N-[4-(5-amino-2-chloro-3-pyridinyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | Nc1cnc(Cl)c(C(O)C(O)CCNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C17H20ClN3O4/c18-16-13(8-12(19)9-21-16)15(23)14(22)6-7-20-17(24)25-10-11-4-2-1-3-5-11/h1-5,8-9,14-15,22-23H,6-7,10,19H2,(H,20,24) |
| InChIKey | PAZVSLYXQZFHHO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|