C16H18FN3O4 — CID 171887865
benzyl N-[4-(2-fluoropyrimidin-5-yl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171887865) has the molecular formula C16H18FN3O4 and a molecular weight of 335.34 g/mol. Its IUPAC name is benzyl N-[4-(2-fluoropyrimidin-5-yl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | benzyl N-[4-(2-fluoropyrimidin-5-yl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171887865 |
| Molecular Formula | C16H18FN3O4 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | benzyl N-[4-(2-fluoropyrimidin-5-yl)-3,4-dihydroxybutyl]carbamate |
| SMILES | O=C(NCCC(O)C(O)c1cnc(F)nc1)OCc1ccccc1 |
| InChI | InChI=1S/C16H18FN3O4/c17-15-19-8-12(9-20-15)14(22)13(21)6-7-18-16(23)24-10-11-4-2-1-3-5-11/h1-5,8-9,13-14,21-22H,6-7,10H2,(H,18,23) |
| InChIKey | KINWSJFEZICVSR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |