C18H18FN3O4 — CID 171888391
benzyl N-[4-(6-cyano-5-fluoro-3-pyridinyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171888391) has the molecular formula C18H18FN3O4 and a molecular weight of 359.36 g/mol. Its IUPAC name is benzyl N-[4-(6-cyano-5-fluoro-3-pyridinyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | benzyl N-[4-(6-cyano-5-fluoro-3-pyridinyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171888391 |
| Molecular Formula | C18H18FN3O4 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | benzyl N-[4-(6-cyano-5-fluoro-3-pyridinyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | N#Cc1ncc(C(O)C(O)CCNC(=O)OCc2ccccc2)cc1F |
| InChI | InChI=1S/C18H18FN3O4/c19-14-8-13(10-22-15(14)9-20)17(24)16(23)6-7-21-18(25)26-11-12-4-2-1-3-5-12/h1-5,8,10,16-17,23-24H,6-7,11H2,(H,21,25) |
| InChIKey | FADMAXGDBQZSJZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |