C18H18ClF2NO4 — CID 171888251
benzyl N-[4-(4-chloro-3,5-difluorophenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171888251) has the molecular formula C18H18ClF2NO4 and a molecular weight of 385.79 g/mol. Its IUPAC name is benzyl N-[4-(4-chloro-3,5-difluorophenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | benzyl N-[4-(4-chloro-3,5-difluorophenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171888251 |
| Molecular Formula | C18H18ClF2NO4 |
| Molecular Weight | 385.79 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | benzyl N-[4-(4-chloro-3,5-difluorophenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | O=C(NCCC(O)C(O)c1cc(F)c(Cl)c(F)c1)OCc1ccccc1 |
| InChI | InChI=1S/C18H18ClF2NO4/c19-16-13(20)8-12(9-14(16)21)17(24)15(23)6-7-22-18(25)26-10-11-4-2-1-3-5-11/h1-5,8-9,15,17,23-24H,6-7,10H2,(H,22,25) |
| InChIKey | PWHIGGWTHZKWQK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.79 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|