C19H21ClFNO4 — CID 171888275
benzyl N-[4-[4-(chloromethyl)-3-fluorophenyl]-3,4-dihydroxybutyl]carbamate (PubChem CID 171888275) has the molecular formula C19H21ClFNO4 and a molecular weight of 381.83 g/mol. Its IUPAC name is benzyl N-[4-[4-(chloromethyl)-3-fluorophenyl]-3,4-dihydroxybutyl]carbamate.
| Compound Name | benzyl N-[4-[4-(chloromethyl)-3-fluorophenyl]-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171888275 |
| Molecular Formula | C19H21ClFNO4 |
| Molecular Weight | 381.83 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | benzyl N-[4-[4-(chloromethyl)-3-fluorophenyl]-3,4-dihydroxybutyl]carbamate |
| SMILES | O=C(NCCC(O)C(O)c1ccc(CCl)c(F)c1)OCc1ccccc1 |
| InChI | InChI=1S/C19H21ClFNO4/c20-11-15-7-6-14(10-16(15)21)18(24)17(23)8-9-22-19(25)26-12-13-4-2-1-3-5-13/h1-7,10,17-18,23-24H,8-9,11-12H2,(H,22,25) |
| InChIKey | UOPZCGCMKBKMSU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.83 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|