C18H19F2NO5 — CID 171888386
benzyl N-[4-(3,5-difluoro-4-hydroxyphenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171888386) has the molecular formula C18H19F2NO5 and a molecular weight of 367.35 g/mol. Its IUPAC name is benzyl N-[4-(3,5-difluoro-4-hydroxyphenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | benzyl N-[4-(3,5-difluoro-4-hydroxyphenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171888386 |
| Molecular Formula | C18H19F2NO5 |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | benzyl N-[4-(3,5-difluoro-4-hydroxyphenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | O=C(NCCC(O)C(O)c1cc(F)c(O)c(F)c1)OCc1ccccc1 |
| InChI | InChI=1S/C18H19F2NO5/c19-13-8-12(9-14(20)17(13)24)16(23)15(22)6-7-21-18(25)26-10-11-4-2-1-3-5-11/h1-5,8-9,15-16,22-24H,6-7,10H2,(H,21,25) |
| InChIKey | WVLCHCMLKKPZGR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |