benzyl N-[4-(3-bromophenyl)-3,4-dihydroxybutyl]carbamate

C18H20BrNO4 — CID 171889475

IUPACbenzyl N-[4-(3-bromophenyl)-3,4-dihydroxybutyl]carbamate
SMILESO=C(NCCC(O)C(O)c1cccc(Br)c1)OCc1ccccc1
InChIInChI=1S/C18H20BrNO4/c19-15-8-4-7-14(11-15)17(22)16(21)9-10-20-18(23)24-12-13-5-2-1-3-6-13/h1-8,11,16-17,21-22H,9-10,12H2,(H,20,23)
InChIKeyXQXMCAVHRWUMJA-UHFFFAOYSA-N
MW394.27 g/mol
LogP3.16
Rot. Bonds7

About benzyl N-[4-(3-bromophenyl)-3,4-dihydroxybutyl]carbamate

benzyl N-[4-(3-bromophenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171889475) has the molecular formula C18H20BrNO4 and a molecular weight of 394.27 g/mol. Its IUPAC name is benzyl N-[4-(3-bromophenyl)-3,4-dihydroxybutyl]carbamate.

Molecular Properties

Compound Namebenzyl N-[4-(3-bromophenyl)-3,4-dihydroxybutyl]carbamate
PubChem CID171889475
Molecular FormulaC18H20BrNO4
Molecular Weight394.27 g/mol
Exact Mass393.06
IUPAC Namebenzyl N-[4-(3-bromophenyl)-3,4-dihydroxybutyl]carbamate
SMILESO=C(NCCC(O)C(O)c1cccc(Br)c1)OCc1ccccc1
InChIInChI=1S/C18H20BrNO4/c19-15-8-4-7-14(11-15)17(22)16(21)9-10-20-18(23)24-12-13-5-2-1-3-6-13/h1-8,11,16-17,21-22H,9-10,12H2,(H,20,23)
InChIKeyXQXMCAVHRWUMJA-UHFFFAOYSA-N
XLogP3.16
TPSA78.79 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500394.27
LogP ≤ 53.16
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze benzyl N-[4-(3-bromophenyl)-3,4-dihydroxybutyl]carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl N-[4-(3-bromophenyl)-3,4-dihydroxybutyl]carbamate?
The IUPAC name of benzyl N-[4-(3-bromophenyl)-3,4-dihydroxybutyl]carbamate (CID 171889475) is benzyl N-[4-(3-bromophenyl)-3,4-dihydroxybutyl]carbamate.
What is the SMILES notation for benzyl N-[4-(3-bromophenyl)-3,4-dihydroxybutyl]carbamate?
The canonical SMILES for benzyl N-[4-(3-bromophenyl)-3,4-dihydroxybutyl]carbamate is O=C(NCCC(O)C(O)c1cccc(Br)c1)OCc1ccccc1.
What is the InChIKey of benzyl N-[4-(3-bromophenyl)-3,4-dihydroxybutyl]carbamate?
The InChIKey is XQXMCAVHRWUMJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20BrNO4/c19-15-8-4-7-14(11-15)17(22)16(21)9-10-20-18(23)24-12-13-5-2-1-3-6-13/h1-8,11,16-17,21-22H,9-10,12H2,(H,20,23).
What are the key properties of benzyl N-[4-(3-bromophenyl)-3,4-dihydroxybutyl]carbamate?
benzyl N-[4-(3-bromophenyl)-3,4-dihydroxybutyl]carbamate has a molecular weight of 394.27 g/mol, XLogP of 3.16, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[4-(3-bromophenyl)-3,4-dihydroxybutyl]carbamate is sourced from PubChem (CID 171889475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).