C18H20BrNO4 — CID 171889475
benzyl N-[4-(3-bromophenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171889475) has the molecular formula C18H20BrNO4 and a molecular weight of 394.27 g/mol. Its IUPAC name is benzyl N-[4-(3-bromophenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | benzyl N-[4-(3-bromophenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171889475 |
| Molecular Formula | C18H20BrNO4 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | benzyl N-[4-(3-bromophenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | O=C(NCCC(O)C(O)c1cccc(Br)c1)OCc1ccccc1 |
| InChI | InChI=1S/C18H20BrNO4/c19-15-8-4-7-14(11-15)17(22)16(21)9-10-20-18(23)24-12-13-5-2-1-3-6-13/h1-8,11,16-17,21-22H,9-10,12H2,(H,20,23) |
| InChIKey | XQXMCAVHRWUMJA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |