C18H21BrN2O4 — CID 171889522
benzyl N-[4-(2-amino-5-bromophenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171889522) has the molecular formula C18H21BrN2O4 and a molecular weight of 409.28 g/mol. Its IUPAC name is benzyl N-[4-(2-amino-5-bromophenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | benzyl N-[4-(2-amino-5-bromophenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171889522 |
| Molecular Formula | C18H21BrN2O4 |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | benzyl N-[4-(2-amino-5-bromophenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | Nc1ccc(Br)cc1C(O)C(O)CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H21BrN2O4/c19-13-6-7-15(20)14(10-13)17(23)16(22)8-9-21-18(24)25-11-12-4-2-1-3-5-12/h1-7,10,16-17,22-23H,8-9,11,20H2,(H,21,24) |
| InChIKey | FVCLSOGAZZCYJQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|