C19H20N2O8 — CID 171889342
2-[1,2-dihydroxy-4-(phenylmethoxycarbonylamino)butyl]-5-nitrobenzoic acid (PubChem CID 171889342) has the molecular formula C19H20N2O8 and a molecular weight of 404.38 g/mol. Its IUPAC name is 2-[1,2-dihydroxy-4-(phenylmethoxycarbonylamino)butyl]-5-nitrobenzoic acid.
| Compound Name | 2-[1,2-dihydroxy-4-(phenylmethoxycarbonylamino)butyl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 171889342 |
| Molecular Formula | C19H20N2O8 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2-[1,2-dihydroxy-4-(phenylmethoxycarbonylamino)butyl]-5-nitrobenzoic acid |
| SMILES | O=C(NCCC(O)C(O)c1ccc([N+](=O)[O-])cc1C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C19H20N2O8/c22-16(8-9-20-19(26)29-11-12-4-2-1-3-5-12)17(23)14-7-6-13(21(27)28)10-15(14)18(24)25/h1-7,10,16-17,22-23H,8-9,11H2,(H,20,26)(H,24,25) |
| InChIKey | IIFZYVROFRRWIO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 159.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|