C13H16N2O7 — CID 171883966
2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoic acid (PubChem CID 171883966) has the molecular formula C13H16N2O7 and a molecular weight of 312.28 g/mol. Its IUPAC name is 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoic acid.
| Compound Name | 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 171883966 |
| Molecular Formula | C13H16N2O7 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoic acid |
| SMILES | CC(=O)NCCC(O)C(O)c1ccc([N+](=O)[O-])cc1C(=O)O |
| InChI | InChI=1S/C13H16N2O7/c1-7(16)14-5-4-11(17)12(18)9-3-2-8(15(21)22)6-10(9)13(19)20/h2-3,6,11-12,17-18H,4-5H2,1H3,(H,14,16)(H,19,20) |
| InChIKey | UQQHBAIPOHFUMM-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|