methyl 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoate

C14H18N2O7 — CID 171884011

IUPACmethyl 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoate
SMILESCOC(=O)c1cc([N+](=O)[O-])ccc1C(O)C(O)CCNC(C)=O
InChIInChI=1S/C14H18N2O7/c1-8(17)15-6-5-12(18)13(19)10-4-3-9(16(21)22)7-11(10)14(20)23-2/h3-4,7,12-13,18-19H,5-6H2,1-2H3,(H,15,17)
InChIKeyPRGNAHXJTZXMBV-UHFFFAOYSA-N
MW326.31 g/mol
LogP0.30
Rot. Bonds7

About methyl 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoate

methyl 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoate (PubChem CID 171884011) has the molecular formula C14H18N2O7 and a molecular weight of 326.31 g/mol. Its IUPAC name is methyl 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoate.

Molecular Properties

Compound Namemethyl 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoate
PubChem CID171884011
Molecular FormulaC14H18N2O7
Molecular Weight326.31 g/mol
Exact Mass326.11
IUPAC Namemethyl 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoate
SMILESCOC(=O)c1cc([N+](=O)[O-])ccc1C(O)C(O)CCNC(C)=O
InChIInChI=1S/C14H18N2O7/c1-8(17)15-6-5-12(18)13(19)10-4-3-9(16(21)22)7-11(10)14(20)23-2/h3-4,7,12-13,18-19H,5-6H2,1-2H3,(H,15,17)
InChIKeyPRGNAHXJTZXMBV-UHFFFAOYSA-N
XLogP0.30
TPSA139.00 Ų
H-Bond Donors3
H-Bond Acceptors7
Rotatable Bonds7
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.31
LogP ≤ 50.30
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoate?
The IUPAC name of methyl 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoate (CID 171884011) is methyl 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoate.
What is the SMILES notation for methyl 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoate?
The canonical SMILES for methyl 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoate is COC(=O)c1cc([N+](=O)[O-])ccc1C(O)C(O)CCNC(C)=O.
What is the InChIKey of methyl 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoate?
The InChIKey is PRGNAHXJTZXMBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O7/c1-8(17)15-6-5-12(18)13(19)10-4-3-9(16(21)22)7-11(10)14(20)23-2/h3-4,7,12-13,18-19H,5-6H2,1-2H3,(H,15,17).
What are the key properties of methyl 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoate?
methyl 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoate has a molecular weight of 326.31 g/mol, XLogP of 0.30, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoate is sourced from PubChem (CID 171884011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).