C14H18N2O7 — CID 171884011
methyl 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoate (PubChem CID 171884011) has the molecular formula C14H18N2O7 and a molecular weight of 326.31 g/mol. Its IUPAC name is methyl 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoate.
| Compound Name | methyl 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoate |
|---|---|
| PubChem CID | 171884011 |
| Molecular Formula | C14H18N2O7 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | methyl 2-(4-acetamido-1,2-dihydroxybutyl)-5-nitrobenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])ccc1C(O)C(O)CCNC(C)=O |
| InChI | InChI=1S/C14H18N2O7/c1-8(17)15-6-5-12(18)13(19)10-4-3-9(16(21)22)7-11(10)14(20)23-2/h3-4,7,12-13,18-19H,5-6H2,1-2H3,(H,15,17) |
| InChIKey | PRGNAHXJTZXMBV-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|