C11H12N4O6 — CID 170826983
methyl 2-(3-azido-1,2-dihydroxypropyl)-5-nitrobenzoate (PubChem CID 170826983) has the molecular formula C11H12N4O6 and a molecular weight of 296.24 g/mol. Its IUPAC name is methyl 2-(3-azido-1,2-dihydroxypropyl)-5-nitrobenzoate.
| Compound Name | methyl 2-(3-azido-1,2-dihydroxypropyl)-5-nitrobenzoate |
|---|---|
| PubChem CID | 170826983 |
| Molecular Formula | C11H12N4O6 |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | methyl 2-(3-azido-1,2-dihydroxypropyl)-5-nitrobenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])ccc1C(O)C(O)CN=[N+]=[N-] |
| InChI | InChI=1S/C11H12N4O6/c1-21-11(18)8-4-6(15(19)20)2-3-7(8)10(17)9(16)5-13-14-12/h2-4,9-10,16-17H,5H2,1H3 |
| InChIKey | IYJYKGKFPHIARO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 158.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|