C8H8ClN5O4 — CID 170826393
3-azido-1-(2-chloro-5-nitro-3-pyridinyl)propane-1,2-diol (PubChem CID 170826393) has the molecular formula C8H8ClN5O4 and a molecular weight of 273.64 g/mol. Its IUPAC name is 3-azido-1-(2-chloro-5-nitro-3-pyridinyl)propane-1,2-diol.
| Compound Name | 3-azido-1-(2-chloro-5-nitro-3-pyridinyl)propane-1,2-diol |
|---|---|
| PubChem CID | 170826393 |
| Molecular Formula | C8H8ClN5O4 |
| Molecular Weight | 273.64 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 3-azido-1-(2-chloro-5-nitro-3-pyridinyl)propane-1,2-diol |
| SMILES | [N-]=[N+]=NCC(O)C(O)c1cc([N+](=O)[O-])cnc1Cl |
| InChI | InChI=1S/C8H8ClN5O4/c9-8-5(1-4(2-11-8)14(17)18)7(16)6(15)3-12-13-10/h1-2,6-7,15-16H,3H2 |
| InChIKey | QMGSHPRQDCFTBH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 145.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.64 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|