C10H11ClN2O6 — CID 171895962
methyl 4-(2-chloro-5-nitro-3-pyridinyl)-3,4-dihydroxybutanoate (PubChem CID 171895962) has the molecular formula C10H11ClN2O6 and a molecular weight of 290.66 g/mol. Its IUPAC name is methyl 4-(2-chloro-5-nitro-3-pyridinyl)-3,4-dihydroxybutanoate.
| Compound Name | methyl 4-(2-chloro-5-nitro-3-pyridinyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171895962 |
| Molecular Formula | C10H11ClN2O6 |
| Molecular Weight | 290.66 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | methyl 4-(2-chloro-5-nitro-3-pyridinyl)-3,4-dihydroxybutanoate |
| SMILES | COC(=O)CC(O)C(O)c1cc([N+](=O)[O-])cnc1Cl |
| InChI | InChI=1S/C10H11ClN2O6/c1-19-8(15)3-7(14)9(16)6-2-5(13(17)18)4-12-10(6)11/h2,4,7,9,14,16H,3H2,1H3 |
| InChIKey | MUHMPPSETUHWGF-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 122.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.66 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|