C10H11ClN2O5S — CID 170822306
S-[3-(2-chloro-5-nitro-3-pyridinyl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170822306) has the molecular formula C10H11ClN2O5S and a molecular weight of 306.73 g/mol. Its IUPAC name is S-[3-(2-chloro-5-nitro-3-pyridinyl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(2-chloro-5-nitro-3-pyridinyl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170822306 |
| Molecular Formula | C10H11ClN2O5S |
| Molecular Weight | 306.73 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | S-[3-(2-chloro-5-nitro-3-pyridinyl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1cc([N+](=O)[O-])cnc1Cl |
| InChI | InChI=1S/C10H11ClN2O5S/c1-5(14)19-4-8(15)9(16)7-2-6(13(17)18)3-12-10(7)11/h2-3,8-9,15-16H,4H2,1H3 |
| InChIKey | UJNZJUYEZFBDTN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 113.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.73 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|