C10H12ClNO3S — CID 170821398
S-[3-(5-chloro-3-pyridinyl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170821398) has the molecular formula C10H12ClNO3S and a molecular weight of 261.73 g/mol. Its IUPAC name is S-[3-(5-chloro-3-pyridinyl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(5-chloro-3-pyridinyl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170821398 |
| Molecular Formula | C10H12ClNO3S |
| Molecular Weight | 261.73 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | S-[3-(5-chloro-3-pyridinyl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1cncc(Cl)c1 |
| InChI | InChI=1S/C10H12ClNO3S/c1-6(13)16-5-9(14)10(15)7-2-8(11)4-12-3-7/h2-4,9-10,14-15H,5H2,1H3 |
| InChIKey | OBUSUHRHSXAOST-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.73 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|