C11H11Cl3O3S — CID 170821757
S-[2,3-dihydroxy-3-(3,4,5-trichlorophenyl)propyl] ethanethioate (PubChem CID 170821757) has the molecular formula C11H11Cl3O3S and a molecular weight of 329.63 g/mol. Its IUPAC name is S-[2,3-dihydroxy-3-(3,4,5-trichlorophenyl)propyl] ethanethioate.
| Compound Name | S-[2,3-dihydroxy-3-(3,4,5-trichlorophenyl)propyl] ethanethioate |
|---|---|
| PubChem CID | 170821757 |
| Molecular Formula | C11H11Cl3O3S |
| Molecular Weight | 329.63 g/mol |
| Exact Mass | 327.95 |
| IUPAC Name | S-[2,3-dihydroxy-3-(3,4,5-trichlorophenyl)propyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H11Cl3O3S/c1-5(15)18-4-9(16)11(17)6-2-7(12)10(14)8(13)3-6/h2-3,9,11,16-17H,4H2,1H3 |
| InChIKey | ZUCURBUTVKSTHV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.63 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|