C13H18O3S — CID 170821482
S-[3-(3,4-dimethylphenyl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170821482) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is S-[3-(3,4-dimethylphenyl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(3,4-dimethylphenyl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170821482 |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | S-[3-(3,4-dimethylphenyl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C13H18O3S/c1-8-4-5-11(6-9(8)2)13(16)12(15)7-17-10(3)14/h4-6,12-13,15-16H,7H2,1-3H3 |
| InChIKey | LPMUDQYOAHOYSJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|