C13H16O3S — CID 170821454
S-[3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170821454) has the molecular formula C13H16O3S and a molecular weight of 252.34 g/mol. Its IUPAC name is S-[3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170821454 |
| Molecular Formula | C13H16O3S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | S-[3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1ccc2c(c1)CC2 |
| InChI | InChI=1S/C13H16O3S/c1-8(14)17-7-12(15)13(16)11-5-3-9-2-4-10(9)6-11/h3,5-6,12-13,15-16H,2,4,7H2,1H3 |
| InChIKey | LWIOMTPRLGQTSX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|