C12H13FO5S — CID 170822207
4-(3-acetylsulfanyl-1,2-dihydroxypropyl)-2-fluorobenzoic acid (PubChem CID 170822207) has the molecular formula C12H13FO5S and a molecular weight of 288.30 g/mol. Its IUPAC name is 4-(3-acetylsulfanyl-1,2-dihydroxypropyl)-2-fluorobenzoic acid.
| Compound Name | 4-(3-acetylsulfanyl-1,2-dihydroxypropyl)-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 170822207 |
| Molecular Formula | C12H13FO5S |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 4-(3-acetylsulfanyl-1,2-dihydroxypropyl)-2-fluorobenzoic acid |
| SMILES | CC(=O)SCC(O)C(O)c1ccc(C(=O)O)c(F)c1 |
| InChI | InChI=1S/C12H13FO5S/c1-6(14)19-5-10(15)11(16)7-2-3-8(12(17)18)9(13)4-7/h2-4,10-11,15-16H,5H2,1H3,(H,17,18) |
| InChIKey | DJEUXMCMFWUYLY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|