C15H14O7S — CID 170822942
6-(3-acetylsulfanyl-1,2-dihydroxypropyl)-2-oxochromene-3-carboxylic acid (PubChem CID 170822942) has the molecular formula C15H14O7S and a molecular weight of 338.34 g/mol. Its IUPAC name is 6-(3-acetylsulfanyl-1,2-dihydroxypropyl)-2-oxochromene-3-carboxylic acid.
| Compound Name | 6-(3-acetylsulfanyl-1,2-dihydroxypropyl)-2-oxochromene-3-carboxylic acid |
|---|---|
| PubChem CID | 170822942 |
| Molecular Formula | C15H14O7S |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 6-(3-acetylsulfanyl-1,2-dihydroxypropyl)-2-oxochromene-3-carboxylic acid |
| SMILES | CC(=O)SCC(O)C(O)c1ccc2oc(=O)c(C(=O)O)cc2c1 |
| InChI | InChI=1S/C15H14O7S/c1-7(16)23-6-11(17)13(18)8-2-3-12-9(4-8)5-10(14(19)20)15(21)22-12/h2-5,11,13,17-18H,6H2,1H3,(H,19,20) |
| InChIKey | CTRHWSVOZJQUDP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|