C11H6O6 — CID 22966
2-oxochromene-3,6-dicarboxylic acid (PubChem CID 22966) has the molecular formula C11H6O6 and a molecular weight of 234.16 g/mol. Its IUPAC name is 2-oxochromene-3,6-dicarboxylic acid.
| Compound Name | 2-oxochromene-3,6-dicarboxylic acid |
|---|---|
| PubChem CID | 22966 |
| Molecular Formula | C11H6O6 |
| Molecular Weight | 234.16 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 2-oxochromene-3,6-dicarboxylic acid |
| SMILES | O=C(O)c1ccc2oc(=O)c(C(=O)O)cc2c1 |
| InChI | InChI=1S/C11H6O6/c12-9(13)5-1-2-8-6(3-5)4-7(10(14)15)11(16)17-8/h1-4H,(H,12,13)(H,14,15) |
| InChIKey | PDLOKWLOCWHAKN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.16 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|