C14H12O8 — CID 171865061
6-(1,2-dihydroxy-3-methoxy-3-oxopropyl)-2-oxochromene-3-carboxylic acid (PubChem CID 171865061) has the molecular formula C14H12O8 and a molecular weight of 308.24 g/mol. Its IUPAC name is 6-(1,2-dihydroxy-3-methoxy-3-oxopropyl)-2-oxochromene-3-carboxylic acid.
| Compound Name | 6-(1,2-dihydroxy-3-methoxy-3-oxopropyl)-2-oxochromene-3-carboxylic acid |
|---|---|
| PubChem CID | 171865061 |
| Molecular Formula | C14H12O8 |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 6-(1,2-dihydroxy-3-methoxy-3-oxopropyl)-2-oxochromene-3-carboxylic acid |
| SMILES | COC(=O)C(O)C(O)c1ccc2oc(=O)c(C(=O)O)cc2c1 |
| InChI | InChI=1S/C14H12O8/c1-21-14(20)11(16)10(15)6-2-3-9-7(4-6)5-8(12(17)18)13(19)22-9/h2-5,10-11,15-16H,1H3,(H,17,18) |
| InChIKey | UPQKMCFRAMASIQ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|